C13H20N4O5S — CID 119329237
2-amino-N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]pentanamide (PubChem CID 119329237) has the molecular formula C13H20N4O5S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-amino-N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]pentanamide.
| Compound Name | 2-amino-N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]pentanamide |
|---|---|
| PubChem CID | 119329237 |
| Molecular Formula | C13H20N4O5S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-amino-N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]pentanamide |
| SMILES | CCCC(N)C(=O)NCCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N4O5S/c1-2-5-10(14)13(18)15-8-9-16-23(21,22)12-7-4-3-6-11(12)17(19)20/h3-4,6-7,10,16H,2,5,8-9,14H2,1H3,(H,15,18) |
| InChIKey | GICXBLRKGFZBLH-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|