C16H18N4O8S2 — CID 3955828
2-nitro-N-[4-[(2-nitrophenyl)sulfonylamino]butyl]benzenesulfonamide (PubChem CID 3955828) has the molecular formula C16H18N4O8S2 and a molecular weight of 458.47 g/mol. Its IUPAC name is 2-nitro-N-[4-[(2-nitrophenyl)sulfonylamino]butyl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[4-[(2-nitrophenyl)sulfonylamino]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3955828 |
| Molecular Formula | C16H18N4O8S2 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 2-nitro-N-[4-[(2-nitrophenyl)sulfonylamino]butyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCCCCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N4O8S2/c21-19(22)13-7-1-3-9-15(13)29(25,26)17-11-5-6-12-18-30(27,28)16-10-4-2-8-14(16)20(23)24/h1-4,7-10,17-18H,5-6,11-12H2 |
| InChIKey | SQCARJJMBMCNKD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 178.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|