C12H18N2O4S — CID 3322272
N-(4-methylpentyl)-2-nitrobenzenesulfonamide (PubChem CID 3322272) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is N-(4-methylpentyl)-2-nitrobenzenesulfonamide.
| Compound Name | N-(4-methylpentyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3322272 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-(4-methylpentyl)-2-nitrobenzenesulfonamide |
| SMILES | CC(C)CCCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N2O4S/c1-10(2)6-5-9-13-19(17,18)12-8-4-3-7-11(12)14(15)16/h3-4,7-8,10,13H,5-6,9H2,1-2H3 |
| InChIKey | AGAYMRXPZDKRRT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|