C32H34N8O16S4 — CID 11104964
2-nitro-N-[3-[(2-nitrophenyl)sulfonyl-[2-[(2-nitrophenyl)sulfonyl-[3-[(2-nitrophenyl)sulfonylamino]propyl]amino]ethyl]amino]propyl]benzenesulfonamide (PubChem CID 11104964) has the molecular formula C32H34N8O16S4 and a molecular weight of 914.93 g/mol. Its IUPAC name is 2-nitro-N-[3-[(2-nitrophenyl)sulfonyl-[2-[(2-nitrophenyl)sulfonyl-[3-[(2-nitrophenyl)sulfonylamino]propyl]amino]ethyl]amino]propyl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[3-[(2-nitrophenyl)sulfonyl-[2-[(2-nitrophenyl)sulfonyl-[3-[(2-nitrophenyl)sulfonylamino]propyl]amino]ethyl]amino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11104964 |
| Molecular Formula | C32H34N8O16S4 |
| Molecular Weight | 914.93 g/mol |
| Exact Mass | 914.10 |
| IUPAC Name | 2-nitro-N-[3-[(2-nitrophenyl)sulfonyl-[2-[(2-nitrophenyl)sulfonyl-[3-[(2-nitrophenyl)sulfonylamino]propyl]amino]ethyl]amino]propyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCCCN(CCN(CCCNS(=O)(=O)c1ccccc1[N+](=O)[O-])S(=O)(=O)c1ccccc1[N+](=O)[O-])S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H34N8O16S4/c41-37(42)25-11-1-5-15-29(25)57(49,50)33-19-9-21-35(59(53,54)31-17-7-3-13-27(31)39(45)46)23-24-36(60(55,56)32-18-8-4-14-28(32)40(47)48)22-10-20-34-58(51,52)30-16-6-2-12-26(30)38(43)44/h1-8,11-18,33-34H,9-10,19-24H2 |
| InChIKey | BLEHRQRVZIPSFY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 339.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.93 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|