C20H30N2O12S — CID 118376471
3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethyl-(2-nitrophenyl)sulfonylamino]ethoxy]ethoxy]propanoic acid (PubChem CID 118376471) has the molecular formula C20H30N2O12S and a molecular weight of 522.53 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethyl-(2-nitrophenyl)sulfonylamino]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethyl-(2-nitrophenyl)sulfonylamino]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 118376471 |
| Molecular Formula | C20H30N2O12S |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethyl-(2-nitrophenyl)sulfonylamino]ethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCN(CCOCCOCCC(=O)O)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H30N2O12S/c23-19(24)5-9-31-13-15-33-11-7-21(8-12-34-16-14-32-10-6-20(25)26)35(29,30)18-4-2-1-3-17(18)22(27)28/h1-4H,5-16H2,(H,23,24)(H,25,26) |
| InChIKey | WDLMAAPAQZDIQO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 192.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|