C13H14N2O9S — CID 141032806
2-[(3-acetyloxy-2-oxopropyl)-(2-nitrophenyl)sulfonylamino]acetic acid (PubChem CID 141032806) has the molecular formula C13H14N2O9S and a molecular weight of 374.33 g/mol. Its IUPAC name is 2-[(3-acetyloxy-2-oxopropyl)-(2-nitrophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[(3-acetyloxy-2-oxopropyl)-(2-nitrophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 141032806 |
| Molecular Formula | C13H14N2O9S |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-[(3-acetyloxy-2-oxopropyl)-(2-nitrophenyl)sulfonylamino]acetic acid |
| SMILES | CC(=O)OCC(=O)CN(CC(=O)O)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N2O9S/c1-9(16)24-8-10(17)6-14(7-13(18)19)25(22,23)12-5-3-2-4-11(12)15(20)21/h2-5H,6-8H2,1H3,(H,18,19) |
| InChIKey | PKHMHJAIFRDSRP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 161.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|