C11H15N3O6S — CID 175359494
3-amino-2-methyl-2-[methyl-(2-nitrophenyl)sulfonylamino]propanoic acid (PubChem CID 175359494) has the molecular formula C11H15N3O6S and a molecular weight of 317.32 g/mol. Its IUPAC name is 3-amino-2-methyl-2-[methyl-(2-nitrophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-amino-2-methyl-2-[methyl-(2-nitrophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 175359494 |
| Molecular Formula | C11H15N3O6S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3-amino-2-methyl-2-[methyl-(2-nitrophenyl)sulfonylamino]propanoic acid |
| SMILES | CN(C(C)(CN)C(=O)O)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N3O6S/c1-11(7-12,10(15)16)13(2)21(19,20)9-6-4-3-5-8(9)14(17)18/h3-6H,7,12H2,1-2H3,(H,15,16) |
| InChIKey | MQRLUIQBAJYDKM-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|