C18H20N2O6S — CID 10500709
(2S)-2-[benzyl-(2-nitrophenyl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 10500709) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is (2S)-2-[benzyl-(2-nitrophenyl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[benzyl-(2-nitrophenyl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 10500709 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (2S)-2-[benzyl-(2-nitrophenyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)N(Cc1ccccc1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N2O6S/c1-13(2)17(18(21)22)19(12-14-8-4-3-5-9-14)27(25,26)16-11-7-6-10-15(16)20(23)24/h3-11,13,17H,12H2,1-2H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | CRVQHMVAXUJMBD-KRWDZBQOSA-N |
| XLogP | 2.89 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|