C22H23NO4S — CID 10810829
(2S)-2-[benzyl(naphthalen-1-ylsulfonyl)amino]-3-methylbutanoic acid (PubChem CID 10810829) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is (2S)-2-[benzyl(naphthalen-1-ylsulfonyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[benzyl(naphthalen-1-ylsulfonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 10810829 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (2S)-2-[benzyl(naphthalen-1-ylsulfonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)N(Cc1ccccc1)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H23NO4S/c1-16(2)21(22(24)25)23(15-17-9-4-3-5-10-17)28(26,27)20-14-8-12-18-11-6-7-13-19(18)20/h3-14,16,21H,15H2,1-2H3,(H,24,25)/t21-/m0/s1 |
| InChIKey | FATZPIVHKUHQEK-NRFANRHFSA-N |
| XLogP | 4.14 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |