C28H30N2O3S2 — CID 4032302
N-benzyl-2-[butan-2-yl(naphthalen-1-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4032302) has the molecular formula C28H30N2O3S2 and a molecular weight of 506.69 g/mol. Its IUPAC name is N-benzyl-2-[butan-2-yl(naphthalen-1-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[butan-2-yl(naphthalen-1-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4032302 |
| Molecular Formula | C28H30N2O3S2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | N-benzyl-2-[butan-2-yl(naphthalen-1-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCC(C)N(CC(=O)N(Cc1ccccc1)Cc1cccs1)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H30N2O3S2/c1-3-22(2)30(35(32,33)27-17-9-14-24-13-7-8-16-26(24)27)21-28(31)29(20-25-15-10-18-34-25)19-23-11-5-4-6-12-23/h4-18,22H,3,19-21H2,1-2H3 |
| InChIKey | WDFWXLLYHAHDHY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |