C27H28N2O3S2 — CID 5140226
N-benzyl-2-[naphthalen-1-ylsulfonyl(propyl)amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 5140226) has the molecular formula C27H28N2O3S2 and a molecular weight of 492.67 g/mol. Its IUPAC name is N-benzyl-2-[naphthalen-1-ylsulfonyl(propyl)amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[naphthalen-1-ylsulfonyl(propyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 5140226 |
| Molecular Formula | C27H28N2O3S2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | N-benzyl-2-[naphthalen-1-ylsulfonyl(propyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H28N2O3S2/c1-2-17-29(34(31,32)26-16-8-13-23-12-6-7-15-25(23)26)21-27(30)28(20-24-14-9-18-33-24)19-22-10-4-3-5-11-22/h3-16,18H,2,17,19-21H2,1H3 |
| InChIKey | OFVKFZYRBRGMOC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |