C24H27FN2O3S2 — CID 3913407
N-benzyl-2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3913407) has the molecular formula C24H27FN2O3S2 and a molecular weight of 474.62 g/mol. Its IUPAC name is N-benzyl-2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3913407 |
| Molecular Formula | C24H27FN2O3S2 |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-benzyl-2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCCCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H27FN2O3S2/c1-2-3-15-27(32(29,30)23-13-11-21(25)12-14-23)19-24(28)26(18-22-10-7-16-31-22)17-20-8-5-4-6-9-20/h4-14,16H,2-3,15,17-19H2,1H3 |
| InChIKey | KFCPFQDZMKNUIM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |