C25H30N2O3S2 — CID 4562295
N-benzyl-2-[butyl-(4-methylphenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4562295) has the molecular formula C25H30N2O3S2 and a molecular weight of 470.66 g/mol. Its IUPAC name is N-benzyl-2-[butyl-(4-methylphenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[butyl-(4-methylphenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4562295 |
| Molecular Formula | C25H30N2O3S2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N-benzyl-2-[butyl-(4-methylphenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCCCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H30N2O3S2/c1-3-4-16-27(32(29,30)24-14-12-21(2)13-15-24)20-25(28)26(19-23-11-8-17-31-23)18-22-9-6-5-7-10-22/h5-15,17H,3-4,16,18-20H2,1-2H3 |
| InChIKey | XWGFCJMWOYIZKS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |