C24H26N2O4S2 — CID 3649754
N-benzyl-2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3649754) has the molecular formula C24H26N2O4S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is N-benzyl-2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3649754 |
| Molecular Formula | C24H26N2O4S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-benzyl-2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H26N2O4S2/c1-3-15-26(32(28,29)23-13-11-21(30-2)12-14-23)19-24(27)25(18-22-10-7-16-31-22)17-20-8-5-4-6-9-20/h3-14,16H,1,15,17-19H2,2H3 |
| InChIKey | DYZWAHYSAUWQGQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|