C26H28N2O4S — CID 4320403
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3,5-dimethoxy-N-prop-2-enylbenzamide (PubChem CID 4320403) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3,5-dimethoxy-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3,5-dimethoxy-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 4320403 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3,5-dimethoxy-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C26H28N2O4S/c1-4-12-27(26(30)21-14-22(31-2)16-23(15-21)32-3)19-25(29)28(18-24-11-8-13-33-24)17-20-9-6-5-7-10-20/h4-11,13-16H,1,12,17-19H2,2-3H3 |
| InChIKey | QPIVPBLQPUZXGQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|