C32H40N2O4S — CID 3438241
N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-pentyl-N-prop-2-enylbenzamide (PubChem CID 3438241) has the molecular formula C32H40N2O4S and a molecular weight of 548.75 g/mol. Its IUPAC name is N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-pentyl-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-pentyl-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 3438241 |
| Molecular Formula | C32H40N2O4S |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-pentyl-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1cccs1)C(=O)c1ccc(CCCCC)cc1 |
| InChI | InChI=1S/C32H40N2O4S/c1-5-7-8-10-25-12-15-27(16-13-25)32(36)34(19-6-2)24-31(35)33(23-28-11-9-21-39-28)20-18-26-14-17-29(37-3)30(22-26)38-4/h6,9,11-17,21-22H,2,5,7-8,10,18-20,23-24H2,1,3-4H3 |
| InChIKey | FBLMJXLHRDIWCN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|