C29H34Cl2N2O5S — CID 3944832
3,5-dichloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-ethoxypropyl)benzamide (PubChem CID 3944832) has the molecular formula C29H34Cl2N2O5S and a molecular weight of 593.57 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-ethoxypropyl)benzamide.
| Compound Name | 3,5-dichloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 3944832 |
| Molecular Formula | C29H34Cl2N2O5S |
| Molecular Weight | 593.57 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | 3,5-dichloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCN(CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1cccs1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C29H34Cl2N2O5S/c1-4-38-13-6-11-33(29(35)22-16-23(30)18-24(31)17-22)20-28(34)32(19-25-7-5-14-39-25)12-10-21-8-9-26(36-2)27(15-21)37-3/h5,7-9,14-18H,4,6,10-13,19-20H2,1-3H3 |
| InChIKey | OVPZQBQEOOTETC-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|