C23H31ClN2O5S — CID 3966116
2-[(2-chloroacetyl)-(3-methoxypropyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3966116) has the molecular formula C23H31ClN2O5S and a molecular weight of 483.03 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-(3-methoxypropyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-(3-methoxypropyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3966116 |
| Molecular Formula | C23H31ClN2O5S |
| Molecular Weight | 483.03 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-[(2-chloroacetyl)-(3-methoxypropyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | COCCCN(CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1cccs1)C(=O)CCl |
| InChI | InChI=1S/C23H31ClN2O5S/c1-29-12-5-10-25(22(27)15-24)17-23(28)26(16-19-6-4-13-32-19)11-9-18-7-8-20(30-2)21(14-18)31-3/h4,6-8,13-14H,5,9-12,15-17H2,1-3H3 |
| InChIKey | UMHMBXRVXBCXHT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.03 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|