C29H36BrN3O5S — CID 5225446
2-[(3-bromophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 5225446) has the molecular formula C29H36BrN3O5S and a molecular weight of 618.59 g/mol. Its IUPAC name is 2-[(3-bromophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(3-bromophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 5225446 |
| Molecular Formula | C29H36BrN3O5S |
| Molecular Weight | 618.59 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | 2-[(3-bromophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCOCCCN(CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1cccs1)C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C29H36BrN3O5S/c1-4-38-16-7-14-33(29(35)31-24-9-5-8-23(30)19-24)21-28(34)32(20-25-10-6-17-39-25)15-13-22-11-12-26(36-2)27(18-22)37-3/h5-6,8-12,17-19H,4,7,13-16,20-21H2,1-3H3,(H,31,35) |
| InChIKey | GZIQVPJFUFLHNC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|