C27H30ClN3O4S — CID 3931657
2-[(4-chlorophenyl)carbamoyl-prop-2-enylamino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3931657) has the molecular formula C27H30ClN3O4S and a molecular weight of 528.07 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoyl-prop-2-enylamino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)carbamoyl-prop-2-enylamino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3931657 |
| Molecular Formula | C27H30ClN3O4S |
| Molecular Weight | 528.07 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoyl-prop-2-enylamino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1cccs1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H30ClN3O4S/c1-4-14-31(27(33)29-22-10-8-21(28)9-11-22)19-26(32)30(18-23-6-5-16-36-23)15-13-20-7-12-24(34-2)25(17-20)35-3/h4-12,16-17H,1,13-15,18-19H2,2-3H3,(H,29,33) |
| InChIKey | LOYDOCBBMCELAE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.07 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|