C30H34N2O4S — CID 4670441
N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-pentyl-N-prop-2-enylbenzamide (PubChem CID 4670441) has the molecular formula C30H34N2O4S and a molecular weight of 518.68 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-pentyl-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-pentyl-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 4670441 |
| Molecular Formula | C30H34N2O4S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-pentyl-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1cccs1)C(=O)c1ccc(CCCCC)cc1 |
| InChI | InChI=1S/C30H34N2O4S/c1-3-5-6-8-23-10-13-25(14-11-23)30(34)31(16-4-2)21-29(33)32(20-26-9-7-17-37-26)19-24-12-15-27-28(18-24)36-22-35-27/h4,7,9-15,17-18H,2-3,5-6,8,16,19-22H2,1H3 |
| InChIKey | AVVGTKGRPOXDJJ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|