C25H24N2O4S — CID 3334595
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enyl-1,3-benzodioxole-5-carboxamide (PubChem CID 3334595) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3334595 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enyl-1,3-benzodioxole-5-carboxamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H24N2O4S/c1-2-12-26(25(29)20-10-11-22-23(14-20)31-18-30-22)17-24(28)27(16-21-9-6-13-32-21)15-19-7-4-3-5-8-19/h2-11,13-14H,1,12,15-18H2 |
| InChIKey | MYDSEPJSJANRJY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|