C27H36N2O4S — CID 4162261
N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enylnonanamide (PubChem CID 4162261) has the molecular formula C27H36N2O4S and a molecular weight of 484.66 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enylnonanamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enylnonanamide |
|---|---|
| PubChem CID | 4162261 |
| Molecular Formula | C27H36N2O4S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enylnonanamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1cccs1)C(=O)CCCCCCCC |
| InChI | InChI=1S/C27H36N2O4S/c1-3-5-6-7-8-9-12-26(30)28(15-4-2)20-27(31)29(19-23-11-10-16-34-23)18-22-13-14-24-25(17-22)33-21-32-24/h4,10-11,13-14,16-17H,2-3,5-9,12,15,18-21H2,1H3 |
| InChIKey | ZRFMVHLENOVBQD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|