C27H38N2O5S — CID 4125431
N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide (PubChem CID 4125431) has the molecular formula C27H38N2O5S and a molecular weight of 502.68 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide |
|---|---|
| PubChem CID | 4125431 |
| Molecular Formula | C27H38N2O5S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide |
| SMILES | CCCCCCCC(=O)N(CCCOC)CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1cccs1 |
| InChI | InChI=1S/C27H38N2O5S/c1-3-4-5-6-7-11-26(30)28(14-9-15-32-2)20-27(31)29(19-23-10-8-16-35-23)18-22-12-13-24-25(17-22)34-21-33-24/h8,10,12-13,16-17H,3-7,9,11,14-15,18-21H2,1-2H3 |
| InChIKey | UZYVFDDOIKXVCQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|