C26H38N2O3S — CID 3979411
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide (PubChem CID 3979411) has the molecular formula C26H38N2O3S and a molecular weight of 458.67 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide |
|---|---|
| PubChem CID | 3979411 |
| Molecular Formula | C26H38N2O3S |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide |
| SMILES | CCCCCCCC(=O)N(CCCOC)CC(=O)N(Cc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C26H38N2O3S/c1-3-4-5-6-10-16-25(29)27(17-12-18-31-2)22-26(30)28(21-24-15-11-19-32-24)20-23-13-8-7-9-14-23/h7-9,11,13-15,19H,3-6,10,12,16-18,20-22H2,1-2H3 |
| InChIKey | WJVPCBDYGQTQAL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|