C23H31FN2O3S — CID 4109622
N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide (PubChem CID 4109622) has the molecular formula C23H31FN2O3S and a molecular weight of 434.58 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide |
|---|---|
| PubChem CID | 4109622 |
| Molecular Formula | C23H31FN2O3S |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide |
| SMILES | CCCCC(=O)N(CCCOC)CC(=O)N(Cc1ccc(F)cc1)Cc1cccs1 |
| InChI | InChI=1S/C23H31FN2O3S/c1-3-4-8-22(27)25(13-6-14-29-2)18-23(28)26(17-21-7-5-15-30-21)16-19-9-11-20(24)12-10-19/h5,7,9-12,15H,3-4,6,8,13-14,16-18H2,1-2H3 |
| InChIKey | LYRCFGPDBQMKGM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|