C25H27ClFN3O3S — CID 5001282
2-[(4-chlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 5001282) has the molecular formula C25H27ClFN3O3S and a molecular weight of 504.03 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 5001282 |
| Molecular Formula | C25H27ClFN3O3S |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccc(F)cc1)Cc1cccs1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H27ClFN3O3S/c1-33-14-3-13-29(25(32)28-22-11-7-20(26)8-12-22)18-24(31)30(17-23-4-2-15-34-23)16-19-5-9-21(27)10-6-19/h2,4-12,15H,3,13-14,16-18H2,1H3,(H,28,32) |
| InChIKey | PGKKSTVHHRXKJB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|