C28H33FN2O3S — CID 4245895
N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)-2-phenylbutanamide (PubChem CID 4245895) has the molecular formula C28H33FN2O3S and a molecular weight of 496.65 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)-2-phenylbutanamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)-2-phenylbutanamide |
|---|---|
| PubChem CID | 4245895 |
| Molecular Formula | C28H33FN2O3S |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)-2-phenylbutanamide |
| SMILES | CCC(C(=O)N(CCCOC)CC(=O)N(Cc1ccc(F)cc1)Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C28H33FN2O3S/c1-3-26(23-9-5-4-6-10-23)28(33)30(16-8-17-34-2)21-27(32)31(20-25-11-7-18-35-25)19-22-12-14-24(29)15-13-22/h4-7,9-15,18,26H,3,8,16-17,19-21H2,1-2H3 |
| InChIKey | OUSCGQJKYTXEFK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|