C28H40N2O5S — CID 4299500
N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)nonanamide (PubChem CID 4299500) has the molecular formula C28H40N2O5S and a molecular weight of 516.70 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)nonanamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)nonanamide |
|---|---|
| PubChem CID | 4299500 |
| Molecular Formula | C28H40N2O5S |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCCOC)CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1cccs1 |
| InChI | InChI=1S/C28H40N2O5S/c1-3-4-5-6-7-8-12-27(31)29(15-10-16-33-2)21-28(32)30(20-24-11-9-17-36-24)19-23-13-14-25-26(18-23)35-22-34-25/h9,11,13-14,17-18H,3-8,10,12,15-16,19-22H2,1-2H3 |
| InChIKey | WNLLOQHKCURQLX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|