C23H29ClN2O5S — CID 3656553
N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-chloro-N-(3-methoxypropyl)butanamide (PubChem CID 3656553) has the molecular formula C23H29ClN2O5S and a molecular weight of 481.01 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-chloro-N-(3-methoxypropyl)butanamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-chloro-N-(3-methoxypropyl)butanamide |
|---|---|
| PubChem CID | 3656553 |
| Molecular Formula | C23H29ClN2O5S |
| Molecular Weight | 481.01 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-chloro-N-(3-methoxypropyl)butanamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1cccs1)C(=O)CCCCl |
| InChI | InChI=1S/C23H29ClN2O5S/c1-29-11-4-10-25(22(27)6-2-9-24)16-23(28)26(15-19-5-3-12-32-19)14-18-7-8-20-21(13-18)31-17-30-20/h3,5,7-8,12-13H,2,4,6,9-11,14-17H2,1H3 |
| InChIKey | HFCXWKDHWZRSAS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.01 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|