C27H40N2O3S — CID 5220571
N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide (PubChem CID 5220571) has the molecular formula C27H40N2O3S and a molecular weight of 472.70 g/mol. Its IUPAC name is N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide.
| Compound Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide |
|---|---|
| PubChem CID | 5220571 |
| Molecular Formula | C27H40N2O3S |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)octanamide |
| SMILES | CCCCCCCC(=O)N(CCCOC)CC(=O)N(Cc1ccccc1)Cc1sccc1C |
| InChI | InChI=1S/C27H40N2O3S/c1-4-5-6-7-11-15-26(30)28(17-12-18-32-3)22-27(31)29(20-24-13-9-8-10-14-24)21-25-23(2)16-19-33-25/h8-10,13-14,16,19H,4-7,11-12,15,17-18,20-22H2,1-3H3 |
| InChIKey | JWWVXTJRWBIWMN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|