C26H32N2O5S2 — CID 5064445
N-benzyl-2-[(4-methoxyphenyl)sulfonyl-(3-methoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 5064445) has the molecular formula C26H32N2O5S2 and a molecular weight of 516.69 g/mol. Its IUPAC name is N-benzyl-2-[(4-methoxyphenyl)sulfonyl-(3-methoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[(4-methoxyphenyl)sulfonyl-(3-methoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 5064445 |
| Molecular Formula | C26H32N2O5S2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | N-benzyl-2-[(4-methoxyphenyl)sulfonyl-(3-methoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccccc1)Cc1sccc1C)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H32N2O5S2/c1-21-14-17-34-25(21)19-27(18-22-8-5-4-6-9-22)26(29)20-28(15-7-16-32-2)35(30,31)24-12-10-23(33-3)11-13-24/h4-6,8-14,17H,7,15-16,18-20H2,1-3H3 |
| InChIKey | KFWITSAASHDNDD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|