C30H34N2O4S2 — CID 4206061
N-benzyl-2-[3-ethoxypropyl(naphthalen-2-ylsulfonyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 4206061) has the molecular formula C30H34N2O4S2 and a molecular weight of 550.75 g/mol. Its IUPAC name is N-benzyl-2-[3-ethoxypropyl(naphthalen-2-ylsulfonyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[3-ethoxypropyl(naphthalen-2-ylsulfonyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 4206061 |
| Molecular Formula | C30H34N2O4S2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | N-benzyl-2-[3-ethoxypropyl(naphthalen-2-ylsulfonyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1sccc1C)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H34N2O4S2/c1-3-36-18-9-17-32(38(34,35)28-15-14-26-12-7-8-13-27(26)20-28)23-30(33)31(21-25-10-5-4-6-11-25)22-29-24(2)16-19-37-29/h4-8,10-16,19-20H,3,9,17-18,21-23H2,1-2H3 |
| InChIKey | XUGUTCQYGVKHEO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|