C27H32BrN3O3S — CID 4252734
N-benzyl-2-[(4-bromophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 4252734) has the molecular formula C27H32BrN3O3S and a molecular weight of 558.54 g/mol. Its IUPAC name is N-benzyl-2-[(4-bromophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[(4-bromophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 4252734 |
| Molecular Formula | C27H32BrN3O3S |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | N-benzyl-2-[(4-bromophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1sccc1C)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C27H32BrN3O3S/c1-3-34-16-7-15-30(27(33)29-24-12-10-23(28)11-13-24)20-26(32)31(18-22-8-5-4-6-9-22)19-25-21(2)14-17-35-25/h4-6,8-14,17H,3,7,15-16,18-20H2,1-2H3,(H,29,33) |
| InChIKey | XFQKVXKRQFZMMU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|