C31H42N2O3S — CID 5099512
N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)adamantane-1-carboxamide (PubChem CID 5099512) has the molecular formula C31H42N2O3S and a molecular weight of 522.76 g/mol. Its IUPAC name is N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)adamantane-1-carboxamide.
| Compound Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 5099512 |
| Molecular Formula | C31H42N2O3S |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)adamantane-1-carboxamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1sccc1C)C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C31H42N2O3S/c1-3-36-12-7-11-32(30(35)31-17-25-14-26(18-31)16-27(15-25)19-31)22-29(34)33(20-24-8-5-4-6-9-24)21-28-23(2)10-13-37-28/h4-6,8-10,13,25-27H,3,7,11-12,14-22H2,1-2H3 |
| InChIKey | GOXAAJRXPDKDFM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|