C27H30N4O7S — CID 3649573
N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3,5-dinitrobenzamide (PubChem CID 3649573) has the molecular formula C27H30N4O7S and a molecular weight of 554.63 g/mol. Its IUPAC name is N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3,5-dinitrobenzamide.
| Compound Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3649573 |
| Molecular Formula | C27H30N4O7S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3,5-dinitrobenzamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1sccc1C)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H30N4O7S/c1-3-38-12-7-11-28(27(33)22-14-23(30(34)35)16-24(15-22)31(36)37)19-26(32)29(17-21-8-5-4-6-9-21)18-25-20(2)10-13-39-25/h4-6,8-10,13-16H,3,7,11-12,17-19H2,1-2H3 |
| InChIKey | DWNZSEGSUOLDNF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|