C28H31N3O4S — CID 3323883
N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-cyclohexyl-3-nitrobenzamide (PubChem CID 3323883) has the molecular formula C28H31N3O4S and a molecular weight of 505.64 g/mol. Its IUPAC name is N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-cyclohexyl-3-nitrobenzamide.
| Compound Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-cyclohexyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 3323883 |
| Molecular Formula | C28H31N3O4S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-cyclohexyl-3-nitrobenzamide |
| SMILES | Cc1ccsc1CN(Cc1ccccc1)C(=O)CN(C(=O)c1cccc([N+](=O)[O-])c1)C1CCCCC1 |
| InChI | InChI=1S/C28H31N3O4S/c1-21-15-16-36-26(21)19-29(18-22-9-4-2-5-10-22)27(32)20-30(24-12-6-3-7-13-24)28(33)23-11-8-14-25(17-23)31(34)35/h2,4-5,8-11,14-17,24H,3,6-7,12-13,18-20H2,1H3 |
| InChIKey | HHVVTDJGAPEZQT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|