C25H24FN3O4S — CID 1028621
N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 1028621) has the molecular formula C25H24FN3O4S and a molecular weight of 481.55 g/mol. Its IUPAC name is N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 1028621 |
| Molecular Formula | C25H24FN3O4S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | Cc1ccsc1CN(Cc1ccc(F)cc1)C(=O)CN(C(=O)c1cccc([N+](=O)[O-])c1)C1CC1 |
| InChI | InChI=1S/C25H24FN3O4S/c1-17-11-12-34-23(17)15-27(14-18-5-7-20(26)8-6-18)24(30)16-28(21-9-10-21)25(31)19-3-2-4-22(13-19)29(32)33/h2-8,11-13,21H,9-10,14-16H2,1H3 |
| InChIKey | BLOXDPVMCRVWMH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|