C25H26N4O4 — CID 1057129
N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-cyclopropyl-3-nitrobenzamide (PubChem CID 1057129) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-cyclopropyl-3-nitrobenzamide.
| Compound Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-cyclopropyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 1057129 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-cyclopropyl-3-nitrobenzamide |
| SMILES | Cn1cccc1CN(Cc1ccccc1)C(=O)CN(C(=O)c1cccc([N+](=O)[O-])c1)C1CC1 |
| InChI | InChI=1S/C25H26N4O4/c1-26-14-6-11-23(26)17-27(16-19-7-3-2-4-8-19)24(30)18-28(21-12-13-21)25(31)20-9-5-10-22(15-20)29(32)33/h2-11,14-15,21H,12-13,16-18H2,1H3 |
| InChIKey | OUEZOCAMBGSFAI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|