C27H37FN2O2S — CID 4690899
N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]nonanamide (PubChem CID 4690899) has the molecular formula C27H37FN2O2S and a molecular weight of 472.67 g/mol. Its IUPAC name is N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]nonanamide.
| Compound Name | N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]nonanamide |
|---|---|
| PubChem CID | 4690899 |
| Molecular Formula | C27H37FN2O2S |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CC(=O)N(Cc1ccc(F)cc1)Cc1sccc1C)C1CC1 |
| InChI | InChI=1S/C27H37FN2O2S/c1-3-4-5-6-7-8-9-26(31)30(24-14-15-24)20-27(32)29(19-25-21(2)16-17-33-25)18-22-10-12-23(28)13-11-22/h10-13,16-17,24H,3-9,14-15,18-20H2,1-2H3 |
| InChIKey | XWJSRHUAGCFHHV-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|