C24H23ClFN3O5S2 — CID 5075384
2-[(4-chloro-3-nitrophenyl)sulfonyl-cyclopropylamino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 5075384) has the molecular formula C24H23ClFN3O5S2 and a molecular weight of 552.05 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)sulfonyl-cyclopropylamino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-cyclopropylamino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 5075384 |
| Molecular Formula | C24H23ClFN3O5S2 |
| Molecular Weight | 552.05 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-cyclopropylamino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccsc1CN(Cc1ccc(F)cc1)C(=O)CN(C1CC1)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23ClFN3O5S2/c1-16-10-11-35-23(16)14-27(13-17-2-4-18(26)5-3-17)24(30)15-28(19-6-7-19)36(33,34)20-8-9-21(25)22(12-20)29(31)32/h2-5,8-12,19H,6-7,13-15H2,1H3 |
| InChIKey | DKHLGNHVAILJJW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.05 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|