C24H25ClFN3O6S2 — CID 4259658
2-[(4-chloro-3-nitrophenyl)sulfonyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4259658) has the molecular formula C24H25ClFN3O6S2 and a molecular weight of 570.06 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)sulfonyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4259658 |
| Molecular Formula | C24H25ClFN3O6S2 |
| Molecular Weight | 570.06 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccc(F)cc1)Cc1cccs1)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H25ClFN3O6S2/c1-35-12-3-11-28(37(33,34)21-9-10-22(25)23(14-21)29(31)32)17-24(30)27(16-20-4-2-13-36-20)15-18-5-7-19(26)8-6-18/h2,4-10,13-14H,3,11-12,15-17H2,1H3 |
| InChIKey | FROPITLHYXKREJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.06 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|