C23H22ClFN2O3S2 — CID 4093220
2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4093220) has the molecular formula C23H22ClFN2O3S2 and a molecular weight of 493.03 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4093220 |
| Molecular Formula | C23H22ClFN2O3S2 |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc(F)cc1)Cc1cccs1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClFN2O3S2/c1-2-13-27(32(29,30)22-11-7-19(24)8-12-22)17-23(28)26(16-21-4-3-14-31-21)15-18-5-9-20(25)10-6-18/h2-12,14H,1,13,15-17H2 |
| InChIKey | DTYPGXRLHUALKF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|