C24H23F3N2O3S2 — CID 3649751
N-benzyl-2-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3649751) has the molecular formula C24H23F3N2O3S2 and a molecular weight of 508.59 g/mol. Its IUPAC name is N-benzyl-2-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3649751 |
| Molecular Formula | C24H23F3N2O3S2 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | N-benzyl-2-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H23F3N2O3S2/c1-2-13-29(34(31,32)22-12-6-10-20(15-22)24(25,26)27)18-23(30)28(17-21-11-7-14-33-21)16-19-8-4-3-5-9-19/h2-12,14-15H,1,13,16-18H2 |
| InChIKey | BWFBFXTZOIEHSO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|