C17H14F3NO2S3 — CID 31010892
N,N-bis(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 31010892) has the molecular formula C17H14F3NO2S3 and a molecular weight of 417.50 g/mol. Its IUPAC name is N,N-bis(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N,N-bis(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 31010892 |
| Molecular Formula | C17H14F3NO2S3 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | N,N-bis(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C17H14F3NO2S3/c18-17(19,20)13-4-1-7-16(10-13)26(22,23)21(11-14-5-2-8-24-14)12-15-6-3-9-25-15/h1-10H,11-12H2 |
| InChIKey | XHJWJUUQTMDBOZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |