C18H14F3NOS2 — CID 55438026
N,N-bis(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzamide (PubChem CID 55438026) has the molecular formula C18H14F3NOS2 and a molecular weight of 381.44 g/mol. Its IUPAC name is N,N-bis(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N,N-bis(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 55438026 |
| Molecular Formula | C18H14F3NOS2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | N,N-bis(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C18H14F3NOS2/c19-18(20,21)14-5-1-4-13(10-14)17(23)22(11-15-6-2-8-24-15)12-16-7-3-9-25-16/h1-10H,11-12H2 |
| InChIKey | XXCJONSASDMECV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |