C18H15N5OS2 — CID 31838484
3-(tetrazol-1-yl)-N,N-bis(thiophen-2-ylmethyl)benzamide (PubChem CID 31838484) has the molecular formula C18H15N5OS2 and a molecular weight of 381.49 g/mol. Its IUPAC name is 3-(tetrazol-1-yl)-N,N-bis(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-(tetrazol-1-yl)-N,N-bis(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 31838484 |
| Molecular Formula | C18H15N5OS2 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 3-(tetrazol-1-yl)-N,N-bis(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1cccc(-n2cnnn2)c1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C18H15N5OS2/c24-18(14-4-1-5-15(10-14)23-13-19-20-21-23)22(11-16-6-2-8-25-16)12-17-7-3-9-26-17/h1-10,13H,11-12H2 |
| InChIKey | YPDOUUHCXDSKBU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |