C15H15N5OS — CID 171132793
4-(tetrazol-1-yl)-N-(3-thiophen-2-ylpropyl)benzamide (PubChem CID 171132793) has the molecular formula C15H15N5OS and a molecular weight of 313.39 g/mol. Its IUPAC name is 4-(tetrazol-1-yl)-N-(3-thiophen-2-ylpropyl)benzamide.
| Compound Name | 4-(tetrazol-1-yl)-N-(3-thiophen-2-ylpropyl)benzamide |
|---|---|
| PubChem CID | 171132793 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-(tetrazol-1-yl)-N-(3-thiophen-2-ylpropyl)benzamide |
| SMILES | O=C(NCCCc1cccs1)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C15H15N5OS/c21-15(16-9-1-3-14-4-2-10-22-14)12-5-7-13(8-6-12)20-11-17-18-19-20/h2,4-8,10-11H,1,3,9H2,(H,16,21) |
| InChIKey | OJGSUKIULIEWGG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|