C13H18N6O2 — CID 104593682
N-[2-(2-hydroxypropylamino)ethyl]-4-(tetrazol-1-yl)benzamide (PubChem CID 104593682) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is N-[2-(2-hydroxypropylamino)ethyl]-4-(tetrazol-1-yl)benzamide.
| Compound Name | N-[2-(2-hydroxypropylamino)ethyl]-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 104593682 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-[2-(2-hydroxypropylamino)ethyl]-4-(tetrazol-1-yl)benzamide |
| SMILES | CC(O)CNCCNC(=O)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C13H18N6O2/c1-10(20)8-14-6-7-15-13(21)11-2-4-12(5-3-11)19-9-16-17-18-19/h2-5,9-10,14,20H,6-8H2,1H3,(H,15,21) |
| InChIKey | FNBKUWHLSUCRFK-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|