C19H14N6O2S — CID 9450376
N-[4-[[4-(tetrazol-1-yl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 9450376) has the molecular formula C19H14N6O2S and a molecular weight of 390.43 g/mol. Its IUPAC name is N-[4-[[4-(tetrazol-1-yl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[4-(tetrazol-1-yl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9450376 |
| Molecular Formula | C19H14N6O2S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-[4-[[4-(tetrazol-1-yl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cnnn2)cc1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H14N6O2S/c26-18(21-15-7-9-16(10-8-15)25-12-20-23-24-25)13-3-5-14(6-4-13)22-19(27)17-2-1-11-28-17/h1-12H,(H,21,26)(H,22,27) |
| InChIKey | KMAHFJFJIKSPRO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |